textstorys1357 textstorys1357
  • 03-11-2021
  • History
contestada

how would life be different in a village with a group of 50 people then thousands of people?

Respuesta :

sssnydersophie
sssnydersophie sssnydersophie
  • 03-11-2021

Answer: The house with thousands of people has a larger population and would be very crowded, things like losing food fast and no room on the couch would happen. But with little population in a house of 50 it would not be so crowded and you could get more done.

Explanation:

Answer Link

Otras preguntas

Hey can anyone help me please?​
If the median of data 7,3,10,5,x is the integer x then find x.​
protains after digestion converted intoa.carbonhydratesb.small globulesc.amino acidsd.starch​
Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl
Use the drop-down menus to complete the sentences. The only way to prevent people from contracting both curable and incurable STIs that is effective 100 percent
Sue likes to run. One day she was running for 3 hours with an average speed of 7 miles per hour. How many miles did she run that day?
PLEASE HELP !! (2/5) -50 POINTS-
what kind of job did Einstein get in in 1902 ? what was he supposed to do​
Write the equation for the line that passes through the points (4, 5) and (6,9). *
Suppose that F(x) = x? and g(x) = -3x? Which statement best compares the graph of G(x) with the graph of F(x)?