3lizabethm0ntoya 3lizabethm0ntoya
  • 03-02-2021
  • English
contestada

what did elie's parents do for work?

Respuesta :

jenny5283
jenny5283 jenny5283
  • 03-02-2021

Answer:

What do Eliezer's parents do for a living? They are bankers. They are shopkeepers.

Answer Link

Otras preguntas

The average rate of a reaction is a good approximation of an instantaneous rate when?
Pls answer before 8:00 pm
Which of the following is an example of gravity moving an object? A ball sitting on a table A ball rolling along the floor A ball placed on a bookshelf A ba
Why do the planets in our solar system orbit in approximately the same plane around the sun?
Draw the products formed when each ester is treated with lithium hydroxide and water. ch3ch2ch(ch3)oc=och(ch3)2−→−−h2olioh
Which of the following scatter plots does not have a zero correlation?
In the bcg matrix, when a division of an organization has a high relative market share and is in a fast-growing industry, it is called a:________
An antibiotic is given repeatedly to treat a recurrent ear infection. it worked initially but now is no longer effective. This indicates that the streptococcus
Which aspect of abbot suger's church at saint-denis represented the new gothic style?
Bonds sold outside the borrower's country and denominated in the currency of the country in which they are sold are called?